About 6,7-dihydroxy-2,3-dihydrochromen-4-one
6,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 23244452) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 6,7-dihydroxy-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6,7-dihydroxy-2,3-dihydrochromen-4-one |
| PubChem CID | 23244452 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 6,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C9H8O4/c10-6-1-2-13-9-4-8(12)7(11)3-5(6)9/h3-4,11-12H,1-2H2 |
| InChIKey | HNDQGSFKMIIAHJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydroxy-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroxy-2,3-dihydrochromen-4-one?
The IUPAC name of 6,7-dihydroxy-2,3-dihydrochromen-4-one (CID 23244452) is 6,7-dihydroxy-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6,7-dihydroxy-2,3-dihydrochromen-4-one?
The canonical SMILES for 6,7-dihydroxy-2,3-dihydrochromen-4-one is O=C1CCOc2cc(O)c(O)cc21.
What is the InChIKey of 6,7-dihydroxy-2,3-dihydrochromen-4-one?
The InChIKey is HNDQGSFKMIIAHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-6-1-2-13-9-4-8(12)7(11)3-5(6)9/h3-4,11-12H,1-2H2.
What are the key properties of 6,7-dihydroxy-2,3-dihydrochromen-4-one?
6,7-dihydroxy-2,3-dihydrochromen-4-one has a molecular weight of 180.16 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroxy-2,3-dihydrochromen-4-one is sourced from PubChem (CID 23244452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).