C12H16BrClO — CID 23244755
3-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran (PubChem CID 23244755) has the molecular formula C12H16BrClO and a molecular weight of 291.62 g/mol. Its IUPAC name is 3-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran.
| Compound Name | 3-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran |
|---|---|
| PubChem CID | 23244755 |
| Molecular Formula | C12H16BrClO |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-[(1S,3S,4S)-3-bromo-4-chloro-4-methylcyclohexyl]-2-methylfuran |
| SMILES | Cc1occc1[C@H]1CC[C@](C)(Cl)[C@@H](Br)C1 |
| InChI | InChI=1S/C12H16BrClO/c1-8-10(4-6-15-8)9-3-5-12(2,14)11(13)7-9/h4,6,9,11H,3,5,7H2,1-2H3/t9-,11-,12-/m0/s1 |
| InChIKey | PIJSECHHFPTCLU-DLOVCJGASA-N |
| XLogP | 4.62 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|