C21H22BrN3O2S — CID 23244768
ethyl 3-[2-[[anilino(methylsulfanyl)methylidene]amino]ethyl]-5-bromo-1H-indole-2-carboxylate (PubChem CID 23244768) has the molecular formula C21H22BrN3O2S and a molecular weight of 460.40 g/mol. Its IUPAC name is ethyl 3-[2-[[anilino(methylsulfanyl)methylidene]amino]ethyl]-5-bromo-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[2-[[anilino(methylsulfanyl)methylidene]amino]ethyl]-5-bromo-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 23244768 |
| Molecular Formula | C21H22BrN3O2S |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | ethyl 3-[2-[[anilino(methylsulfanyl)methylidene]amino]ethyl]-5-bromo-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(Br)cc2c1CC/N=C(/Nc1ccccc1)SC |
| InChI | InChI=1S/C21H22BrN3O2S/c1-3-27-20(26)19-16(17-13-14(22)9-10-18(17)25-19)11-12-23-21(28-2)24-15-7-5-4-6-8-15/h4-10,13,25H,3,11-12H2,1-2H3,(H,23,24) |
| InChIKey | AMZMOXJTKYDWJW-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|