C22H32O8 — CID 23244771
[(2S,4R,8S)-4-acetyloxy-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate (PubChem CID 23244771) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(2S,4R,8S)-4-acetyloxy-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate.
| Compound Name | [(2S,4R,8S)-4-acetyloxy-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate |
|---|---|
| PubChem CID | 23244771 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(2S,4R,8S)-4-acetyloxy-2-[(1S)-1-acetyloxyheptyl]-5-oxo-2,3,4,6,7,8-hexahydrochromen-8-yl] acetate |
| SMILES | CCCCCC[C@H](OC(C)=O)[C@@H]1C[C@@H](OC(C)=O)C2=C(O1)[C@@H](OC(C)=O)CCC2=O |
| InChI | InChI=1S/C22H32O8/c1-5-6-7-8-9-17(27-13(2)23)19-12-20(29-15(4)25)21-16(26)10-11-18(22(21)30-19)28-14(3)24/h17-20H,5-12H2,1-4H3/t17-,18-,19-,20+/m0/s1 |
| InChIKey | DVYVBZOIEXCJRU-LWYYNNOASA-N |
| XLogP | 3.16 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|