C29H40O18 — CID 23244794
[(1R,2R,3S,4R,5R)-2,3,4-triacetyloxy-5-[(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxycyclohexyl]methyl acetate (PubChem CID 23244794) has the molecular formula C29H40O18 and a molecular weight of 676.62 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5R)-2,3,4-triacetyloxy-5-[(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxycyclohexyl]methyl acetate.
| Compound Name | [(1R,2R,3S,4R,5R)-2,3,4-triacetyloxy-5-[(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxycyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 23244794 |
| Molecular Formula | C29H40O18 |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | [(1R,2R,3S,4R,5R)-2,3,4-triacetyloxy-5-[(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxycyclohexyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)O[C@@H]2COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H40O18/c1-12(30)38-10-20-9-21(24(41-15(4)33)26(42-16(5)34)23(20)40-14(3)32)46-25-22(11-39-13(2)31)47-29(45-19(8)37)28(44-18(7)36)27(25)43-17(6)35/h20-29H,9-11H2,1-8H3/t20-,21-,22-,23-,24-,25-,26+,27+,28-,29+/m1/s1 |
| InChIKey | BRGNGZKFUXBSRQ-KDWCHVJKSA-N |
| XLogP | -0.17 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|