C15H17N5 — CID 2324502
N-[2-(2-cyanoethyl)-5-methylpyrazol-3-yl]-N'-methylbenzenecarboximidamide (PubChem CID 2324502) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[2-(2-cyanoethyl)-5-methylpyrazol-3-yl]-N'-methylbenzenecarboximidamide.
| Compound Name | N-[2-(2-cyanoethyl)-5-methylpyrazol-3-yl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 2324502 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[2-(2-cyanoethyl)-5-methylpyrazol-3-yl]-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(/Nc1cc(C)nn1CCC#N)c1ccccc1 |
| InChI | InChI=1S/C15H17N5/c1-12-11-14(20(19-12)10-6-9-16)18-15(17-2)13-7-4-3-5-8-13/h3-5,7-8,11H,6,10H2,1-2H3,(H,17,18) |
| InChIKey | OFKILLPFCWTLHD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|