C23H38F6O3Si — CID 23245530
ethyl (2Z,9Z)-12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoate (PubChem CID 23245530) has the molecular formula C23H38F6O3Si and a molecular weight of 504.63 g/mol. Its IUPAC name is ethyl (2Z,9Z)-12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoate.
| Compound Name | ethyl (2Z,9Z)-12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoate |
|---|---|
| PubChem CID | 23245530 |
| Molecular Formula | C23H38F6O3Si |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | ethyl (2Z,9Z)-12,12,12-trifluoro-7,7-dimethyl-11-triethylsilyloxy-11-(trifluoromethyl)dodeca-2,9-dienoate |
| SMILES | CCOC(=O)/C=C\CCCC(C)(C)C/C=C\C(O[Si](CC)(CC)CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H38F6O3Si/c1-7-31-19(30)15-12-11-13-16-20(5,6)17-14-18-21(22(24,25)26,23(27,28)29)32-33(8-2,9-3)10-4/h12,14-15,18H,7-11,13,16-17H2,1-6H3/b15-12-,18-14- |
| InChIKey | SQSKIPCHIISHCM-DKIWBGQLSA-N |
| XLogP | 8.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|