C11H12O2 — CID 23245881
(2S,3S)-2-phenyl-3,6-dihydro-2H-pyran-3-ol (PubChem CID 23245881) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3S)-2-phenyl-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 23245881 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2S,3S)-2-phenyl-3,6-dihydro-2H-pyran-3-ol |
| SMILES | O[C@H]1C=CCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-7,10-12H,8H2/t10-,11-/m0/s1 |
| InChIKey | OZDORZBYBRIUET-QWRGUYRKSA-N |
| XLogP | 1.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|