C57H37N5O2 — CID 23245924
2-methyl-3-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)benzo[f]isoindole-4,9-dione (PubChem CID 23245924) has the molecular formula C57H37N5O2 and a molecular weight of 823.96 g/mol. Its IUPAC name is 2-methyl-3-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)benzo[f]isoindole-4,9-dione.
| Compound Name | 2-methyl-3-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)benzo[f]isoindole-4,9-dione |
|---|---|
| PubChem CID | 23245924 |
| Molecular Formula | C57H37N5O2 |
| Molecular Weight | 823.96 g/mol |
| Exact Mass | 823.29 |
| IUPAC Name | 2-methyl-3-(5,10,15,20-tetraphenyl-22,24-dihydroporphyrin-2-yl)benzo[f]isoindole-4,9-dione |
| SMILES | Cn1cc2c(c1C1=Cc3nc1c(-c1ccccc1)c1ccc([nH]1)c(-c1ccccc1)c1nc(c(-c4ccccc4)c4ccc([nH]4)c3-c3ccccc3)C=C1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C57H37N5O2/c1-62-33-41-53(57(64)39-25-15-14-24-38(39)56(41)63)55(62)40-32-48-51(36-20-10-4-11-21-36)46-29-28-44(59-46)49(34-16-6-2-7-17-34)42-26-27-43(58-42)50(35-18-8-3-9-19-35)45-30-31-47(60-45)52(54(40)61-48)37-22-12-5-13-23-37/h2-33,59-60H,1H3/b49-42-,49-44-,50-43-,50-45-,51-46-,51-48-,52-47-,54-52- |
| InChIKey | BAAIFNNBJVJRIH-AFIOQXPISA-N |
| XLogP | 12.86 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.96 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|