C11H9Br2NO4 — CID 23246566
(1S,2S,6S,7S)-1,11-dibromo-4-ethyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione (PubChem CID 23246566) has the molecular formula C11H9Br2NO4 and a molecular weight of 379.00 g/mol. Its IUPAC name is (1S,2S,6S,7S)-1,11-dibromo-4-ethyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione.
| Compound Name | (1S,2S,6S,7S)-1,11-dibromo-4-ethyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
|---|---|
| PubChem CID | 23246566 |
| Molecular Formula | C11H9Br2NO4 |
| Molecular Weight | 379.00 g/mol |
| Exact Mass | 376.89 |
| IUPAC Name | (1S,2S,6S,7S)-1,11-dibromo-4-ethyl-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-3,5,9-trione |
| SMILES | CCN1C(=O)[C@@H]2[C@@H]3OC(=O)[C@@](Br)(C=C3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C11H9Br2NO4/c1-2-14-8(15)5-6(9(14)16)11(13)3-4(12)7(5)18-10(11)17/h3,5-7H,2H2,1H3/t5-,6-,7+,11+/m0/s1 |
| InChIKey | XKZDSTIJRADXLZ-UEZPWLPBSA-N |
| XLogP | 0.96 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.00 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|