About ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate
ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 2324658) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate |
| PubChem CID | 2324658 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(N(C)C)n1 |
| InChI | InChI=1S/C9H14N2O2S/c1-4-13-8(12)5-7-6-14-9(10-7)11(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | CTYMSWDHFSBASJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate (CID 2324658) is ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate is CCOC(=O)Cc1csc(N(C)C)n1.
What is the InChIKey of ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate?
The InChIKey is CTYMSWDHFSBASJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-4-13-8(12)5-7-6-14-9(10-7)11(2)3/h6H,4-5H2,1-3H3.
What are the key properties of ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate has a molecular weight of 214.29 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(dimethylamino)-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 2324658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).