C10H10F3NO3 — CID 2324670
N-[2-(3,4-dihydroxyphenyl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 2324670) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 2324670 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)9(17)14-4-3-6-1-2-7(15)8(16)5-6/h1-2,5,15-16H,3-4H2,(H,14,17) |
| InChIKey | JJYLBMVSKRNRPC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|