C35H36N4O5 — CID 23247049
1-[(2R,3S,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-benzylmethanimine oxide (PubChem CID 23247049) has the molecular formula C35H36N4O5 and a molecular weight of 592.70 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-benzylmethanimine oxide.
| Compound Name | 1-[(2R,3S,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-benzylmethanimine oxide |
|---|---|
| PubChem CID | 23247049 |
| Molecular Formula | C35H36N4O5 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | 1-[(2R,3S,4R,5R,6R)-3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-N-benzylmethanimine oxide |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C35H36N4O5/c36-38-37-33-31(22-39(40)21-27-13-5-1-6-14-27)44-32(26-41-23-28-15-7-2-8-16-28)34(42-24-29-17-9-3-10-18-29)35(33)43-25-30-19-11-4-12-20-30/h1-20,22,31-35H,21,23-26H2/b39-22-/t31-,32+,33-,34-,35+/m0/s1 |
| InChIKey | WICDLZBRFSGRJZ-MENXNCQQSA-N |
| XLogP | 6.60 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|