C20H28O3 — CID 23247417
(1R,2S,8Z,11Z,13S,14R,16S)-2-[(1R,2S)-2-ethylcyclopropyl]-3,15-dioxatricyclo[11.4.0.014,16]heptadeca-8,11-dien-4-one (PubChem CID 23247417) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2S,8Z,11Z,13S,14R,16S)-2-[(1R,2S)-2-ethylcyclopropyl]-3,15-dioxatricyclo[11.4.0.014,16]heptadeca-8,11-dien-4-one.
| Compound Name | (1R,2S,8Z,11Z,13S,14R,16S)-2-[(1R,2S)-2-ethylcyclopropyl]-3,15-dioxatricyclo[11.4.0.014,16]heptadeca-8,11-dien-4-one |
|---|---|
| PubChem CID | 23247417 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,2S,8Z,11Z,13S,14R,16S)-2-[(1R,2S)-2-ethylcyclopropyl]-3,15-dioxatricyclo[11.4.0.014,16]heptadeca-8,11-dien-4-one |
| SMILES | CC[C@H]1C[C@H]1[C@@H]1OC(=O)CCC/C=C\C/C=C\[C@H]2[C@H]1C[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C20H28O3/c1-2-13-11-15(13)19-16-12-17-20(22-17)14(16)9-7-5-3-4-6-8-10-18(21)23-19/h3-4,7,9,13-17,19-20H,2,5-6,8,10-12H2,1H3/b4-3-,9-7-/t13-,14-,15+,16+,17-,19-,20+/m0/s1 |
| InChIKey | YJRNYEWLGNTSHT-SRHJZBNWSA-N |
| XLogP | 4.03 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|