About 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione
8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione (PubChem CID 23247475) has the molecular formula C11H6O6
and a molecular weight of 234.16 g/mol. Its IUPAC name is 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione.
Molecular Properties
| Compound Name | 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione |
| PubChem CID | 23247475 |
| Molecular Formula | C11H6O6 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione |
| SMILES | COc1c2c(cc3c1C(=O)OC3=O)COC2=O |
| InChI | InChI=1S/C11H6O6/c1-15-8-6-4(3-16-10(6)13)2-5-7(8)11(14)17-9(5)12/h2H,3H2,1H3 |
| InChIKey | YUPNBRGUBJVTJD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione?
The IUPAC name of 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione (CID 23247475) is 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione.
What is the SMILES notation for 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione?
The canonical SMILES for 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione is COc1c2c(cc3c1C(=O)OC3=O)COC2=O.
What is the InChIKey of 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione?
The InChIKey is YUPNBRGUBJVTJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6O6/c1-15-8-6-4(3-16-10(6)13)2-5-7(8)11(14)17-9(5)12/h2H,3H2,1H3.
What are the key properties of 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione?
8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione has a molecular weight of 234.16 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-5H-furo[3,4-f][2]benzofuran-1,3,7-trione is sourced from PubChem (CID 23247475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).