C24H18N2O4 — CID 23247888
2,5-bis(1H-indol-3-yl)-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 23247888) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2,5-bis(1H-indol-3-yl)-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(1H-indol-3-yl)-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 23247888 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2,5-bis(1H-indol-3-yl)-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(c2c[nH]c3ccccc23)C(=O)C(OC)=C(c2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C24H18N2O4/c1-29-23-19(15-11-25-17-9-5-3-7-13(15)17)22(28)24(30-2)20(21(23)27)16-12-26-18-10-6-4-8-14(16)18/h3-12,25-26H,1-2H3 |
| InChIKey | IVPGMNQTDHNSBX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|