C33H54O4Si2 — CID 23248213
(2R,3R,4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-2,4,6-trimethylheptanal (PubChem CID 23248213) has the molecular formula C33H54O4Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-2,4,6-trimethylheptanal.
| Compound Name | (2R,3R,4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-2,4,6-trimethylheptanal |
|---|---|
| PubChem CID | 23248213 |
| Molecular Formula | C33H54O4Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | (2R,3R,4S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-2,4,6-trimethylheptanal |
| SMILES | CO[C@H]([C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C33H54O4Si2/c1-25(23-34)30(35-10)27(3)31(37-38(11,12)32(4,5)6)26(2)24-36-39(33(7,8)9,28-19-15-13-16-20-28)29-21-17-14-18-22-29/h13-23,25-27,30-31H,24H2,1-12H3/t25-,26-,27-,30-,31-/m0/s1 |
| InChIKey | QSWSNUSLUOWGPN-YETVUXLRSA-N |
| XLogP | 7.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|