C19H24N5O14P2-3 — CID 23248221
[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-oxo-4-(phosphonatoamino)pyrimidin-1-yl]oxolan-3-yl] phosphate (PubChem CID 23248221) has the molecular formula C19H24N5O14P2-3 and a molecular weight of 608.37 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-oxo-4-(phosphonatoamino)pyrimidin-1-yl]oxolan-3-yl] phosphate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-oxo-4-(phosphonatoamino)pyrimidin-1-yl]oxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 23248221 |
| Molecular Formula | C19H24N5O14P2-3 |
| Molecular Weight | 608.37 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl [(2R,3S,5R)-2-(hydroxymethyl)-5-[2-oxo-4-(phosphonatoamino)pyrimidin-1-yl]oxolan-3-yl] phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])O[C@H]3C[C@H](n4ccc(NP(=O)([O-])[O-])nc4=O)O[C@@H]3CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H27N5O14P2/c1-9-6-24(19(29)21-17(9)27)15-4-10(26)13(37-15)8-35-40(33,34)38-11-5-16(36-12(11)7-25)23-3-2-14(20-18(23)28)22-39(30,31)32/h2-3,6,10-13,15-16,25-26H,4-5,7-8H2,1H3,(H,33,34)(H,21,27,29)(H3,20,22,28,30,31,32)/p-3/t10-,11-,12+,13+,15+,16+/m0/s1 |
| InChIKey | XRASUDOSWSFHBM-SWTKMSQOSA-K |
| XLogP | -3.86 |
| TPSA | 282.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.37 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|