C7H10O4S — CID 23248300
(1S,2S)-3-methylsulfonylcyclohexa-3,5-diene-1,2-diol (PubChem CID 23248300) has the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. Its IUPAC name is (1S,2S)-3-methylsulfonylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-3-methylsulfonylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 23248300 |
| Molecular Formula | C7H10O4S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | (1S,2S)-3-methylsulfonylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CS(=O)(=O)C1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H10O4S/c1-12(10,11)6-4-2-3-5(8)7(6)9/h2-5,7-9H,1H3/t5-,7-/m0/s1 |
| InChIKey | WSIKISWEXMTSSH-FSPLSTOPSA-N |
| XLogP | -0.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |