C23H18N2O2S2 — CID 23248766
(4R,4aR,7aR)-6-phenyl-2-phenylimino-4-thiophen-2-yl-3,4,4a,7a-tetrahydrothiopyrano[2,3-c]pyrrole-5,7-dione (PubChem CID 23248766) has the molecular formula C23H18N2O2S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (4R,4aR,7aR)-6-phenyl-2-phenylimino-4-thiophen-2-yl-3,4,4a,7a-tetrahydrothiopyrano[2,3-c]pyrrole-5,7-dione.
| Compound Name | (4R,4aR,7aR)-6-phenyl-2-phenylimino-4-thiophen-2-yl-3,4,4a,7a-tetrahydrothiopyrano[2,3-c]pyrrole-5,7-dione |
|---|---|
| PubChem CID | 23248766 |
| Molecular Formula | C23H18N2O2S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (4R,4aR,7aR)-6-phenyl-2-phenylimino-4-thiophen-2-yl-3,4,4a,7a-tetrahydrothiopyrano[2,3-c]pyrrole-5,7-dione |
| SMILES | O=C1[C@@H]2[C@@H](S/C(=N\c3ccccc3)C[C@H]2c2cccs2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2S2/c26-22-20-17(18-12-7-13-28-18)14-19(24-15-8-3-1-4-9-15)29-21(20)23(27)25(22)16-10-5-2-6-11-16/h1-13,17,20-21H,14H2/b24-19-/t17-,20-,21+/m0/s1 |
| InChIKey | GBXKRLCJKDOAPC-WQAMBDEPSA-N |
| XLogP | 5.26 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|