C18H25NO10 — CID 23249088
[(1S,2R,6S,7R,8R,8aR)-1,6,7,8-tetraacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate (PubChem CID 23249088) has the molecular formula C18H25NO10 and a molecular weight of 415.40 g/mol. Its IUPAC name is [(1S,2R,6S,7R,8R,8aR)-1,6,7,8-tetraacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate.
| Compound Name | [(1S,2R,6S,7R,8R,8aR)-1,6,7,8-tetraacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate |
|---|---|
| PubChem CID | 23249088 |
| Molecular Formula | C18H25NO10 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [(1S,2R,6S,7R,8R,8aR)-1,6,7,8-tetraacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)CN2C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C18H25NO10/c1-8(20)25-13-6-19-7-14(26-9(2)21)17(28-11(4)23)18(29-12(5)24)15(19)16(13)27-10(3)22/h13-18H,6-7H2,1-5H3/t13-,14+,15-,16-,17-,18-/m1/s1 |
| InChIKey | CYJXVMYGFMXYLQ-SISKNIMQSA-N |
| XLogP | -0.66 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|