C12H24O4 — CID 23249217
(3R,5R,6S)-5-(methoxymethoxy)-6-methylnon-8-ene-1,3-diol (PubChem CID 23249217) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3R,5R,6S)-5-(methoxymethoxy)-6-methylnon-8-ene-1,3-diol.
| Compound Name | (3R,5R,6S)-5-(methoxymethoxy)-6-methylnon-8-ene-1,3-diol |
|---|---|
| PubChem CID | 23249217 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (3R,5R,6S)-5-(methoxymethoxy)-6-methylnon-8-ene-1,3-diol |
| SMILES | C=CC[C@H](C)[C@@H](C[C@H](O)CCO)OCOC |
| InChI | InChI=1S/C12H24O4/c1-4-5-10(2)12(16-9-15-3)8-11(14)6-7-13/h4,10-14H,1,5-9H2,2-3H3/t10-,11+,12+/m0/s1 |
| InChIKey | WYLMXZWLJUSAAJ-QJPTWQEYSA-N |
| XLogP | 1.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|