C37H53NO10 — CID 23249268
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 23249268) has the molecular formula C37H53NO10 and a molecular weight of 671.83 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23249268 |
| Molecular Formula | C37H53NO10 |
| Molecular Weight | 671.83 g/mol |
| Exact Mass | 671.37 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2R)-4-oxo-2-phenyl-2,3-dihydropyridin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](N2C=CC(=O)C[C@@H]2c2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C37H53NO10/c1-34(2,3)30(40)44-21-25-26(46-31(41)35(4,5)6)27(47-32(42)36(7,8)9)28(48-33(43)37(10,11)12)29(45-25)38-19-18-23(39)20-24(38)22-16-14-13-15-17-22/h13-19,24-29H,20-21H2,1-12H3/t24-,25-,26+,27+,28-,29-/m1/s1 |
| InChIKey | WKOYPQONUKGMAP-SDPIAUFMSA-N |
| XLogP | 5.70 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|