C7H11O15P3-6 — CID 23249298
[(1R,2S,3R,4S,5R,6R)-2,4-dihydroxy-5-methoxy-3,6-diphosphonatooxycyclohexyl] phosphate (PubChem CID 23249298) has the molecular formula C7H11O15P3-6 and a molecular weight of 428.07 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5R,6R)-2,4-dihydroxy-5-methoxy-3,6-diphosphonatooxycyclohexyl] phosphate.
| Compound Name | [(1R,2S,3R,4S,5R,6R)-2,4-dihydroxy-5-methoxy-3,6-diphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 23249298 |
| Molecular Formula | C7H11O15P3-6 |
| Molecular Weight | 428.07 g/mol |
| Exact Mass | 427.93 |
| IUPAC Name | [(1R,2S,3R,4S,5R,6R)-2,4-dihydroxy-5-methoxy-3,6-diphosphonatooxycyclohexyl] phosphate |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](OP(=O)([O-])[O-])[C@H](O)[C@@H](OP(=O)([O-])[O-])[C@@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C7H17O15P3/c1-19-5-2(8)4(20-23(10,11)12)3(9)6(21-24(13,14)15)7(5)22-25(16,17)18/h2-9H,1H3,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/p-6/t2-,3+,4-,5-,6-,7-/m1/s1 |
| InChIKey | KIKVCENLXISBNR-IPQSZEQASA-H |
| XLogP | -6.62 |
| TPSA | 266.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.07 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|