About 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium
1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium (PubChem CID 2324932) has the molecular formula C16H13N2O+
and a molecular weight of 249.29 g/mol. Its IUPAC name is 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium.
Molecular Properties
| Compound Name | 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium |
| PubChem CID | 2324932 |
| Molecular Formula | C16H13N2O+ |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium |
| SMILES | C[n+]1c(-c2ccccc2)oc2ccc3[nH]ccc3c21 |
| InChI | InChI=1S/C16H13N2O/c1-18-15-12-9-10-17-13(12)7-8-14(15)19-16(18)11-5-3-2-4-6-11/h2-10,17H,1H3/q+1 |
| InChIKey | FOAOMGHOTLMTCU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium?
The IUPAC name of 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium (CID 2324932) is 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium.
What is the SMILES notation for 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium?
The canonical SMILES for 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium is C[n+]1c(-c2ccccc2)oc2ccc3[nH]ccc3c21.
What is the InChIKey of 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium?
The InChIKey is FOAOMGHOTLMTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N2O/c1-18-15-12-9-10-17-13(12)7-8-14(15)19-16(18)11-5-3-2-4-6-11/h2-10,17H,1H3/q+1.
What are the key properties of 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium?
1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium has a molecular weight of 249.29 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-phenyl-6H-pyrrolo[3,2-e][1,3]benzoxazol-1-ium is sourced from PubChem (CID 2324932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).