C30H30O6 — CID 23249451
(2R,4aR,6S,7R,8S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 23249451) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7R,8S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 23249451 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (2R,4aR,6S,7R,8S,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-6-prop-2-ynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C#CCO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H30O6/c1-2-18-31-30-28(33-20-23-14-8-4-9-15-23)27(32-19-22-12-6-3-7-13-22)26-25(35-30)21-34-29(36-26)24-16-10-5-11-17-24/h1,3-17,25-30H,18-21H2/t25-,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | FVSISHMLMDBEHM-APTUCROKSA-N |
| XLogP | 4.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|