C10H15N3O4 — CID 23249839
1-[(1Z,3E)-3-methyl-2,4-dinitrobuta-1,3-dienyl]piperidine (PubChem CID 23249839) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-[(1Z,3E)-3-methyl-2,4-dinitrobuta-1,3-dienyl]piperidine.
| Compound Name | 1-[(1Z,3E)-3-methyl-2,4-dinitrobuta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 23249839 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-[(1Z,3E)-3-methyl-2,4-dinitrobuta-1,3-dienyl]piperidine |
| SMILES | CC(=C\[N+](=O)[O-])/C(=C/N1CCCCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O4/c1-9(7-12(14)15)10(13(16)17)8-11-5-3-2-4-6-11/h7-8H,2-6H2,1H3/b9-7+,10-8- |
| InChIKey | GUWARIVTZWMMGM-ZWOQCJTASA-N |
| XLogP | 1.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|