C30H36O9 — CID 23250012
[(4S,6S,12S)-4-[(2R)-2-methoxy-2-phenylacetyl]oxy-12-methyl-2,5-dioxo-oxacyclododec-6-yl] (2R)-2-methoxy-2-phenylacetate (PubChem CID 23250012) has the molecular formula C30H36O9 and a molecular weight of 540.61 g/mol. Its IUPAC name is [(4S,6S,12S)-4-[(2R)-2-methoxy-2-phenylacetyl]oxy-12-methyl-2,5-dioxo-oxacyclododec-6-yl] (2R)-2-methoxy-2-phenylacetate.
| Compound Name | [(4S,6S,12S)-4-[(2R)-2-methoxy-2-phenylacetyl]oxy-12-methyl-2,5-dioxo-oxacyclododec-6-yl] (2R)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 23250012 |
| Molecular Formula | C30H36O9 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | [(4S,6S,12S)-4-[(2R)-2-methoxy-2-phenylacetyl]oxy-12-methyl-2,5-dioxo-oxacyclododec-6-yl] (2R)-2-methoxy-2-phenylacetate |
| SMILES | CO[C@@H](C(=O)O[C@H]1CCCCC[C@H](C)OC(=O)C[C@H](OC(=O)[C@H](OC)c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C30H36O9/c1-20-13-7-4-12-18-23(38-29(33)27(35-2)21-14-8-5-9-15-21)26(32)24(19-25(31)37-20)39-30(34)28(36-3)22-16-10-6-11-17-22/h5-6,8-11,14-17,20,23-24,27-28H,4,7,12-13,18-19H2,1-3H3/t20-,23-,24-,27+,28+/m0/s1 |
| InChIKey | IKNKSHBIEACZOC-QAVQDNNBSA-N |
| XLogP | 4.44 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|