C24H29NO2 — CID 23250032
(1S,2S,3S)-3-benzyl-2-[[(1S)-1-phenylethyl]-prop-2-enylamino]cyclopentane-1-carboxylic acid (PubChem CID 23250032) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (1S,2S,3S)-3-benzyl-2-[[(1S)-1-phenylethyl]-prop-2-enylamino]cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S)-3-benzyl-2-[[(1S)-1-phenylethyl]-prop-2-enylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 23250032 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (1S,2S,3S)-3-benzyl-2-[[(1S)-1-phenylethyl]-prop-2-enylamino]cyclopentane-1-carboxylic acid |
| SMILES | C=CCN([C@H]1[C@H](Cc2ccccc2)CC[C@@H]1C(=O)O)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-3-16-25(18(2)20-12-8-5-9-13-20)23-21(14-15-22(23)24(26)27)17-19-10-6-4-7-11-19/h3-13,18,21-23H,1,14-17H2,2H3,(H,26,27)/t18-,21-,22-,23-/m0/s1 |
| InChIKey | OLONGEUBWJELGE-QGQQZZQASA-N |
| XLogP | 4.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|