About [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium
[(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium (PubChem CID 23250054) has the molecular formula C6H16N2O+2
and a molecular weight of 132.21 g/mol. Its IUPAC name is [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium.
Molecular Properties
| Compound Name | [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium |
| PubChem CID | 23250054 |
| Molecular Formula | C6H16N2O+2 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium |
| SMILES | [NH3+][C@H]1[C@H](O)CCC[C@@H]1[NH3+] |
| InChI | InChI=1S/C6H14N2O/c7-4-2-1-3-5(9)6(4)8/h4-6,9H,1-3,7-8H2/p+2/t4-,5+,6+/m0/s1 |
| InChIKey | YDEUDTWDFHWNQN-KVQBGUIXSA-P |
| XLogP | -2.25 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium?
The IUPAC name of [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium (CID 23250054) is [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium.
What is the SMILES notation for [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium?
The canonical SMILES for [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium is [NH3+][C@H]1[C@H](O)CCC[C@@H]1[NH3+].
What is the InChIKey of [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium?
The InChIKey is YDEUDTWDFHWNQN-KVQBGUIXSA-P. The full InChI is InChI=1S/C6H14N2O/c7-4-2-1-3-5(9)6(4)8/h4-6,9H,1-3,7-8H2/p+2/t4-,5+,6+/m0/s1.
What are the key properties of [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium?
[(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium has a molecular weight of 132.21 g/mol, XLogP of -2.25, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R,3R)-2-azaniumyl-3-hydroxycyclohexyl]azanium is sourced from PubChem (CID 23250054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).