C5H14N2O2+2 — CID 23250057
[(1S,2R,3R,4S)-2-azaniumyl-3,4-dihydroxycyclopentyl]azanium (PubChem CID 23250057) has the molecular formula C5H14N2O2+2 and a molecular weight of 134.18 g/mol. Its IUPAC name is [(1S,2R,3R,4S)-2-azaniumyl-3,4-dihydroxycyclopentyl]azanium.
| Compound Name | [(1S,2R,3R,4S)-2-azaniumyl-3,4-dihydroxycyclopentyl]azanium |
|---|---|
| PubChem CID | 23250057 |
| Molecular Formula | C5H14N2O2+2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | [(1S,2R,3R,4S)-2-azaniumyl-3,4-dihydroxycyclopentyl]azanium |
| SMILES | [NH3+][C@H]1[C@@H](O)[C@@H](O)C[C@@H]1[NH3+] |
| InChI | InChI=1S/C5H12N2O2/c6-2-1-3(8)5(9)4(2)7/h2-5,8-9H,1,6-7H2/p+2/t2-,3-,4+,5-/m0/s1 |
| InChIKey | SPUJACCASZGKBX-KLVWXMOXSA-P |
| XLogP | -3.67 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |