C22H31NO6 — CID 23250114
ethyl 2-[(3aR,4R,6R,6aS)-5-benzyl-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetate (PubChem CID 23250114) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is ethyl 2-[(3aR,4R,6R,6aS)-5-benzyl-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetate.
| Compound Name | ethyl 2-[(3aR,4R,6R,6aS)-5-benzyl-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetate |
|---|---|
| PubChem CID | 23250114 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | ethyl 2-[(3aR,4R,6R,6aS)-5-benzyl-4-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2[C@@H](CC(=O)OCC)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO6/c1-5-26-18(24)12-16-20-21(29-22(3,4)28-20)17(13-19(25)27-6-2)23(16)14-15-10-8-7-9-11-15/h7-11,16-17,20-21H,5-6,12-14H2,1-4H3/t16-,17-,20-,21+/m1/s1 |
| InChIKey | QMONKATXOXKGMB-DGQTTZFYSA-N |
| XLogP | 2.67 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |