C14H17N3O3S — CID 23250384
[(2S,3S,4S,6S)-4-azido-2-methyl-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 23250384) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is [(2S,3S,4S,6S)-4-azido-2-methyl-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,6S)-4-azido-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 23250384 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [(2S,3S,4S,6S)-4-azido-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](N=[N+]=[N-])C[C@H](Sc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C14H17N3O3S/c1-9-14(20-10(2)18)12(16-17-15)8-13(19-9)21-11-6-4-3-5-7-11/h3-7,9,12-14H,8H2,1-2H3/t9-,12-,13-,14+/m0/s1 |
| InChIKey | NMLSBVHAEGMGJS-NZPIUUIZSA-N |
| XLogP | 3.52 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|