C13H11BrCl2F3NO — CID 23250673
1-[(3S,4R)-6-bromo-3,4-dichloro-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 23250673) has the molecular formula C13H11BrCl2F3NO and a molecular weight of 405.04 g/mol. Its IUPAC name is 1-[(3S,4R)-6-bromo-3,4-dichloro-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3S,4R)-6-bromo-3,4-dichloro-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 23250673 |
| Molecular Formula | C13H11BrCl2F3NO |
| Molecular Weight | 405.04 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 1-[(3S,4R)-6-bromo-3,4-dichloro-2,2-dimethyl-3,4-dihydroquinolin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1(C)[C@H](Cl)[C@H](Cl)c2cc(Br)ccc2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11BrCl2F3NO/c1-12(2)10(16)9(15)7-5-6(14)3-4-8(7)20(12)11(21)13(17,18)19/h3-5,9-10H,1-2H3/t9-,10-/m1/s1 |
| InChIKey | IDTRIMBSBPUUGQ-NXEZZACHSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.04 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|