C4H2N10O2 — CID 23250697
3-azido-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole (PubChem CID 23250697) has the molecular formula C4H2N10O2 and a molecular weight of 222.13 g/mol. Its IUPAC name is 3-azido-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole.
| Compound Name | 3-azido-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 23250697 |
| Molecular Formula | C4H2N10O2 |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 3-azido-1-(5-nitro-1H-1,2,4-triazol-3-yl)-1,2,4-triazole |
| SMILES | [N-]=[N+]=Nc1ncn(-c2n[nH]c([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C4H2N10O2/c5-12-8-2-6-1-13(11-2)3-7-4(10-9-3)14(15)16/h1H,(H,7,9,10) |
| InChIKey | VYYFEBZVLOXBBQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 164.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|