C15H20O2Te — CID 23250720
1-[(Z)-2-ethoxy-1-phenyltellanylethenyl]cyclopentan-1-ol (PubChem CID 23250720) has the molecular formula C15H20O2Te and a molecular weight of 359.92 g/mol. Its IUPAC name is 1-[(Z)-2-ethoxy-1-phenyltellanylethenyl]cyclopentan-1-ol.
| Compound Name | 1-[(Z)-2-ethoxy-1-phenyltellanylethenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 23250720 |
| Molecular Formula | C15H20O2Te |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 1-[(Z)-2-ethoxy-1-phenyltellanylethenyl]cyclopentan-1-ol |
| SMILES | CCO/C=C(\[Te]c1ccccc1)C1(O)CCCC1 |
| InChI | InChI=1S/C15H20O2Te/c1-2-17-12-14(15(16)10-6-7-11-15)18-13-8-4-3-5-9-13/h3-5,8-9,12,16H,2,6-7,10-11H2,1H3/b14-12- |
| InChIKey | XIJNQGJTVDUXSH-OWBHPGMISA-N |
| XLogP | 2.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|