About 1,5,6-trinitrobenzimidazole
1,5,6-trinitrobenzimidazole (PubChem CID 23250728) has the molecular formula C7H3N5O6
and a molecular weight of 253.13 g/mol. Its IUPAC name is 1,5,6-trinitrobenzimidazole.
Molecular Properties
| Compound Name | 1,5,6-trinitrobenzimidazole |
| PubChem CID | 23250728 |
| Molecular Formula | C7H3N5O6 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 1,5,6-trinitrobenzimidazole |
| SMILES | O=[N+]([O-])c1cc2ncn([N+](=O)[O-])c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3N5O6/c13-10(14)6-1-4-5(2-7(6)11(15)16)9(3-8-4)12(17)18/h1-3H |
| InChIKey | OBDSOZSXDZMFKK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 147.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5,6-trinitrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,6-trinitrobenzimidazole?
The IUPAC name of 1,5,6-trinitrobenzimidazole (CID 23250728) is 1,5,6-trinitrobenzimidazole.
What is the SMILES notation for 1,5,6-trinitrobenzimidazole?
The canonical SMILES for 1,5,6-trinitrobenzimidazole is O=[N+]([O-])c1cc2ncn([N+](=O)[O-])c2cc1[N+](=O)[O-].
What is the InChIKey of 1,5,6-trinitrobenzimidazole?
The InChIKey is OBDSOZSXDZMFKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N5O6/c13-10(14)6-1-4-5(2-7(6)11(15)16)9(3-8-4)12(17)18/h1-3H.
What are the key properties of 1,5,6-trinitrobenzimidazole?
1,5,6-trinitrobenzimidazole has a molecular weight of 253.13 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,6-trinitrobenzimidazole is sourced from PubChem (CID 23250728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).