C21H40BNO4Si — CID 23250816
[(R)-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-trimethylsilylmethyl] N,N-di(propan-2-yl)carbamate (PubChem CID 23250816) has the molecular formula C21H40BNO4Si and a molecular weight of 409.45 g/mol. Its IUPAC name is [(R)-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-trimethylsilylmethyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(R)-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-trimethylsilylmethyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 23250816 |
| Molecular Formula | C21H40BNO4Si |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | [(R)-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-trimethylsilylmethyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@@H](B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C21H40BNO4Si/c1-13(2)23(14(3)4)19(24)25-18(28(8,9)10)22-26-17-12-15-11-16(20(15,5)6)21(17,7)27-22/h13-18H,11-12H2,1-10H3/t15-,16-,17+,18+,21-/m0/s1 |
| InChIKey | FBRQTFAICVUKTO-KAUDDPROSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|