C19H22INO5 — CID 23250870
(3S,4S)-4-[(3aR,5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-enylazetidin-2-one (PubChem CID 23250870) has the molecular formula C19H22INO5 and a molecular weight of 471.29 g/mol. Its IUPAC name is (3S,4S)-4-[(3aR,5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4S)-4-[(3aR,5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 23250870 |
| Molecular Formula | C19H22INO5 |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | (3S,4S)-4-[(3aR,5R,6S,6aS)-6-iodo-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@@H](Oc2ccccc2)[C@H]1[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1I |
| InChI | InChI=1S/C19H22INO5/c1-4-10-21-13(16(17(21)22)23-11-8-6-5-7-9-11)14-12(20)15-18(24-14)26-19(2,3)25-15/h4-9,12-16,18H,1,10H2,2-3H3/t12-,13+,14-,15+,16-,18+/m0/s1 |
| InChIKey | YHKGWWFTBGPBTM-ICELYOSQSA-N |
| XLogP | 2.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|