C19H23NO5 — CID 23250871
(1S,2S,3R,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadecan-4-one (PubChem CID 23250871) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (1S,2S,3R,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadecan-4-one.
| Compound Name | (1S,2S,3R,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadecan-4-one |
|---|---|
| PubChem CID | 23250871 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (1S,2S,3R,9S,10R,14R)-12,12-dimethyl-3-phenoxy-11,13,15-trioxa-5-azatetracyclo[7.6.0.02,5.010,14]pentadecan-4-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](CCCN4C(=O)[C@H](Oc5ccccc5)[C@H]34)[C@H]2O1 |
| InChI | InChI=1S/C19H23NO5/c1-19(2)24-15-12-9-6-10-20-13(14(12)23-18(15)25-19)16(17(20)21)22-11-7-4-3-5-8-11/h3-5,7-8,12-16,18H,6,9-10H2,1-2H3/t12-,13-,14-,15+,16+,18+/m0/s1 |
| InChIKey | PENRBPMBYLBRKO-VVHNNWHFSA-N |
| XLogP | 1.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |