C26H29NO5 — CID 23250877
(1S,2R,3S,7R,8S,9R,13R)-7-benzyl-11,11-dimethyl-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one (PubChem CID 23250877) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is (1S,2R,3S,7R,8S,9R,13R)-7-benzyl-11,11-dimethyl-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one.
| Compound Name | (1S,2R,3S,7R,8S,9R,13R)-7-benzyl-11,11-dimethyl-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one |
|---|---|
| PubChem CID | 23250877 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (1S,2R,3S,7R,8S,9R,13R)-7-benzyl-11,11-dimethyl-3-phenylmethoxy-10,12,14-trioxa-5-azatetracyclo[6.6.0.02,5.09,13]tetradecan-4-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H]([C@@H](Cc4ccccc4)CN4C(=O)[C@@H](OCc5ccccc5)[C@@H]34)[C@H]2O1 |
| InChI | InChI=1S/C26H29NO5/c1-26(2)31-22-19-18(13-16-9-5-3-6-10-16)14-27-20(21(19)30-25(22)32-26)23(24(27)28)29-15-17-11-7-4-8-12-17/h3-12,18-23,25H,13-15H2,1-2H3/t18-,19-,20+,21-,22+,23-,25+/m0/s1 |
| InChIKey | ZGXUWUJBKAEWQW-GCTLWFEKSA-N |
| XLogP | 3.15 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |