About 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione
6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione (PubChem CID 23251264) has the molecular formula C15H11Br2NOS
and a molecular weight of 413.13 g/mol. Its IUPAC name is 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione.
Molecular Properties
| Compound Name | 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione |
| PubChem CID | 23251264 |
| Molecular Formula | C15H11Br2NOS |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione |
| SMILES | Cc1ccc(N2Cc3cc(Br)cc(Br)c3OC2=S)cc1 |
| InChI | InChI=1S/C15H11Br2NOS/c1-9-2-4-12(5-3-9)18-8-10-6-11(16)7-13(17)14(10)19-15(18)20/h2-7H,8H2,1H3 |
| InChIKey | WXIRTOZWYPFJHZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione?
The IUPAC name of 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione (CID 23251264) is 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione.
What is the SMILES notation for 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione?
The canonical SMILES for 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione is Cc1ccc(N2Cc3cc(Br)cc(Br)c3OC2=S)cc1.
What is the InChIKey of 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione?
The InChIKey is WXIRTOZWYPFJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Br2NOS/c1-9-2-4-12(5-3-9)18-8-10-6-11(16)7-13(17)14(10)19-15(18)20/h2-7H,8H2,1H3.
What are the key properties of 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione?
6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione has a molecular weight of 413.13 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-3-(4-methylphenyl)-4H-1,3-benzoxazine-2-thione is sourced from PubChem (CID 23251264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).