C18H29NO4 — CID 23251576
tert-butyl (1S,2S,6R,7R)-8-butyl-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate (PubChem CID 23251576) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is tert-butyl (1S,2S,6R,7R)-8-butyl-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate.
| Compound Name | tert-butyl (1S,2S,6R,7R)-8-butyl-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate |
|---|---|
| PubChem CID | 23251576 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl (1S,2S,6R,7R)-8-butyl-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylate |
| SMILES | CCCCC1=C[C@H]2[C@@H]3OC(C)(C)O[C@@H]3[C@@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO4/c1-7-8-9-11-10-12-14-15(22-18(5,6)21-14)13(11)19(12)16(20)23-17(2,3)4/h10,12-15H,7-9H2,1-6H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | CWBMLYTZCVBXFJ-LJISPDSOSA-N |
| XLogP | 3.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|