C19H25NO2 — CID 23251688
tert-butyl (2Z)-2-[(E)-3-phenylprop-2-enylidene]piperidine-1-carboxylate (PubChem CID 23251688) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[(E)-3-phenylprop-2-enylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2Z)-2-[(E)-3-phenylprop-2-enylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23251688 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | tert-butyl (2Z)-2-[(E)-3-phenylprop-2-enylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC/C1=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-19(2,3)22-18(21)20-15-8-7-13-17(20)14-9-12-16-10-5-4-6-11-16/h4-6,9-12,14H,7-8,13,15H2,1-3H3/b12-9+,17-14- |
| InChIKey | QVYCWWSJVSJKBI-XXBFHDLNSA-N |
| XLogP | 5.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |