C6H6ClIO2 — CID 23251845
(1S,2R)-3-chloro-6-iodocyclohexa-3,5-diene-1,2-diol (PubChem CID 23251845) has the molecular formula C6H6ClIO2 and a molecular weight of 272.47 g/mol. Its IUPAC name is (1S,2R)-3-chloro-6-iodocyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-chloro-6-iodocyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 23251845 |
| Molecular Formula | C6H6ClIO2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 271.91 |
| IUPAC Name | (1S,2R)-3-chloro-6-iodocyclohexa-3,5-diene-1,2-diol |
| SMILES | O[C@@H]1C(I)=CC=C(Cl)[C@@H]1O |
| InChI | InChI=1S/C6H6ClIO2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,5-6,9-10H/t5-,6+/m0/s1 |
| InChIKey | INQGWURQNONRAZ-NTSWFWBYSA-N |
| XLogP | 1.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|