C26H38O7 — CID 23252103
[(1S,2S,3R,4R,5R,7S,8R,11S,12R,17S)-12-acetyloxy-5,8,11-trimethyl-15-methylidene-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate (PubChem CID 23252103) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,7S,8R,11S,12R,17S)-12-acetyloxy-5,8,11-trimethyl-15-methylidene-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate.
| Compound Name | [(1S,2S,3R,4R,5R,7S,8R,11S,12R,17S)-12-acetyloxy-5,8,11-trimethyl-15-methylidene-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate |
|---|---|
| PubChem CID | 23252103 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(1S,2S,3R,4R,5R,7S,8R,11S,12R,17S)-12-acetyloxy-5,8,11-trimethyl-15-methylidene-14-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate |
| SMILES | C=C1C[C@@H]2O[C@H]3[C@H]4[C@@H](C[C@@H](C)[C@@H](OC(=O)CCC)[C@H]42)[C@@H](C)CO[C@@]3(C)[C@H](OC(C)=O)CC1=O |
| InChI | InChI=1S/C26H38O7/c1-7-8-21(29)33-24-14(3)9-17-15(4)12-30-26(6)20(31-16(5)27)11-18(28)13(2)10-19-23(24)22(17)25(26)32-19/h14-15,17,19-20,22-25H,2,7-12H2,1,3-6H3/t14-,15+,17+,19+,20-,22+,23+,24-,25+,26+/m1/s1 |
| InChIKey | ATAZXGNJBNBIBQ-KFGRSKAASA-N |
| XLogP | 3.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|