C19H20O4 — CID 23252570
(1S)-1-(hydroxymethyl)-6,6-dimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione (PubChem CID 23252570) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (1S)-1-(hydroxymethyl)-6,6-dimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione.
| Compound Name | (1S)-1-(hydroxymethyl)-6,6-dimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
|---|---|
| PubChem CID | 23252570 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (1S)-1-(hydroxymethyl)-6,6-dimethyl-2,7,8,9-tetrahydro-1H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| SMILES | CC1(C)CCCc2c1ccc1c2C(=O)C(=O)C2=C1OC[C@@H]2CO |
| InChI | InChI=1S/C19H20O4/c1-19(2)7-3-4-11-13(19)6-5-12-15(11)17(22)16(21)14-10(8-20)9-23-18(12)14/h5-6,10,20H,3-4,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | RLHQXRPMHRPPEA-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|