C11H18O6 — CID 23252584
(1R)-1-[(3aR,5R,6R,6aR)-6-ethenyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol (PubChem CID 23252584) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6R,6aR)-6-ethenyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3aR,5R,6R,6aR)-6-ethenyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 23252584 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (1R)-1-[(3aR,5R,6R,6aR)-6-ethenyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
| SMILES | C=C[C@@]1(O)[C@@H]([C@H](O)CO)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H18O6/c1-4-11(14)7(6(13)5-12)15-9-8(11)16-10(2,3)17-9/h4,6-9,12-14H,1,5H2,2-3H3/t6-,7-,8+,9-,11-/m1/s1 |
| InChIKey | SXBHSOOTSJWRQL-ZBGLXGBJSA-N |
| XLogP | -0.87 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|