C22H23ClF2O2S — CID 23252922
[(2S,3R)-1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfanylhex-5-en-2-yl] (2R)-2-phenylpropanoate (PubChem CID 23252922) has the molecular formula C22H23ClF2O2S and a molecular weight of 424.94 g/mol. Its IUPAC name is [(2S,3R)-1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfanylhex-5-en-2-yl] (2R)-2-phenylpropanoate.
| Compound Name | [(2S,3R)-1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfanylhex-5-en-2-yl] (2R)-2-phenylpropanoate |
|---|---|
| PubChem CID | 23252922 |
| Molecular Formula | C22H23ClF2O2S |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [(2S,3R)-1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfanylhex-5-en-2-yl] (2R)-2-phenylpropanoate |
| SMILES | C=CC[C@@H](Sc1ccc(C)cc1)[C@H](OC(=O)[C@H](C)c1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C22H23ClF2O2S/c1-4-8-19(28-18-13-11-15(2)12-14-18)20(22(23,24)25)27-21(26)16(3)17-9-6-5-7-10-17/h4-7,9-14,16,19-20H,1,8H2,2-3H3/t16-,19-,20+/m1/s1 |
| InChIKey | MRXOYTRYKYCWPC-AHRSYUTCSA-N |
| XLogP | 6.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|