C14H21NO4 — CID 23252928
2-O-tert-butyl 6-O-methyl (1S,4S,6S)-2-azabicyclo[2.2.2]oct-7-ene-2,6-dicarboxylate (PubChem CID 23252928) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-O-tert-butyl 6-O-methyl (1S,4S,6S)-2-azabicyclo[2.2.2]oct-7-ene-2,6-dicarboxylate.
| Compound Name | 2-O-tert-butyl 6-O-methyl (1S,4S,6S)-2-azabicyclo[2.2.2]oct-7-ene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 23252928 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-O-tert-butyl 6-O-methyl (1S,4S,6S)-2-azabicyclo[2.2.2]oct-7-ene-2,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2C=C[C@@H]1N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C14H21NO4/c1-14(2,3)19-13(17)15-8-9-5-6-11(15)10(7-9)12(16)18-4/h5-6,9-11H,7-8H2,1-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | NRRIDVLOIXRRBO-VWYCJHECSA-N |
| XLogP | 1.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|